C11H13FO2 — CID 130870256
methyl 2-(2-fluoro-3,6-dimethylphenyl)acetate (PubChem CID 130870256) has the molecular formula C11H13FO2 and a molecular weight of 196.22 g/mol. Its IUPAC name is methyl 2-(2-fluoro-3,6-dimethylphenyl)acetate.
| Compound Name | methyl 2-(2-fluoro-3,6-dimethylphenyl)acetate |
|---|---|
| PubChem CID | 130870256 |
| Molecular Formula | C11H13FO2 |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | methyl 2-(2-fluoro-3,6-dimethylphenyl)acetate |
| SMILES | COC(=O)Cc1c(C)ccc(C)c1F |
| InChI | InChI=1S/C11H13FO2/c1-7-4-5-8(2)11(12)9(7)6-10(13)14-3/h4-5H,6H2,1-3H3 |
| InChIKey | QZWGNJXTCLNBFC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |