About [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanamine
[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanamine (PubChem CID 130870814) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanamine.
Molecular Properties
| Compound Name | [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanamine |
| PubChem CID | 130870814 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanamine |
| SMILES | CC1(C)[C@H]2CC=C(CN)[C@@H]1C2 |
| InChI | InChI=1S/C10H17N/c1-10(2)8-4-3-7(6-11)9(10)5-8/h3,8-9H,4-6,11H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | QLYNKVYEESZNIS-IUCAKERBSA-N |
| XLogP | 1.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanamine?
The IUPAC name of [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanamine (CID 130870814) is [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanamine.
What is the SMILES notation for [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanamine?
The canonical SMILES for [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanamine is CC1(C)[C@H]2CC=C(CN)[C@@H]1C2.
What is the InChIKey of [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanamine?
The InChIKey is QLYNKVYEESZNIS-IUCAKERBSA-N. The full InChI is InChI=1S/C10H17N/c1-10(2)8-4-3-7(6-11)9(10)5-8/h3,8-9H,4-6,11H2,1-2H3/t8-,9-/m0/s1.
What are the key properties of [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanamine?
[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanamine has a molecular weight of 151.25 g/mol, XLogP of 1.94, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanamine is sourced from PubChem (CID 130870814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).