About 3-(2-iodophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine
3-(2-iodophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine (PubChem CID 130871179) has the molecular formula C10H11IN2O
and a molecular weight of 302.11 g/mol. Its IUPAC name is 3-(2-iodophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine.
Molecular Properties
| Compound Name | 3-(2-iodophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine |
| PubChem CID | 130871179 |
| Molecular Formula | C10H11IN2O |
| Molecular Weight | 302.11 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 3-(2-iodophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine |
| SMILES | NC1=NC(c2ccccc2I)COC1 |
| InChI | InChI=1S/C10H11IN2O/c11-8-4-2-1-3-7(8)9-5-14-6-10(12)13-9/h1-4,9H,5-6H2,(H2,12,13) |
| InChIKey | CSVPGUUAPKFRRN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.11 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-iodophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-iodophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine?
The IUPAC name of 3-(2-iodophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine (CID 130871179) is 3-(2-iodophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine.
What is the SMILES notation for 3-(2-iodophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine?
The canonical SMILES for 3-(2-iodophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine is NC1=NC(c2ccccc2I)COC1.
What is the InChIKey of 3-(2-iodophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine?
The InChIKey is CSVPGUUAPKFRRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11IN2O/c11-8-4-2-1-3-7(8)9-5-14-6-10(12)13-9/h1-4,9H,5-6H2,(H2,12,13).
What are the key properties of 3-(2-iodophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine?
3-(2-iodophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine has a molecular weight of 302.11 g/mol, XLogP of 1.72, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-iodophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine is sourced from PubChem (CID 130871179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).