C9H14N2O2S — CID 130871608
(3-methoxyoxolan-3-yl)-(1,2-thiazol-5-yl)methanamine (PubChem CID 130871608) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is (3-methoxyoxolan-3-yl)-(1,2-thiazol-5-yl)methanamine.
| Compound Name | (3-methoxyoxolan-3-yl)-(1,2-thiazol-5-yl)methanamine |
|---|---|
| PubChem CID | 130871608 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (3-methoxyoxolan-3-yl)-(1,2-thiazol-5-yl)methanamine |
| SMILES | COC1(C(N)c2ccns2)CCOC1 |
| InChI | InChI=1S/C9H14N2O2S/c1-12-9(3-5-13-6-9)8(10)7-2-4-11-14-7/h2,4,8H,3,5-6,10H2,1H3 |
| InChIKey | IMOZGUVYARQOPL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |