About cyclopropyl(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)methanone
cyclopropyl(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)methanone (PubChem CID 130872132) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is cyclopropyl(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)methanone.
Molecular Properties
| Compound Name | cyclopropyl(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)methanone |
| PubChem CID | 130872132 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | cyclopropyl(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)methanone |
| SMILES | O=C(C1CC1)N1Cc2cn[nH]c2C1 |
| InChI | InChI=1S/C9H11N3O/c13-9(6-1-2-6)12-4-7-3-10-11-8(7)5-12/h3,6H,1-2,4-5H2,(H,10,11) |
| InChIKey | GYDGNCBUEIMOMH-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopropyl(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)methanone?
The IUPAC name of cyclopropyl(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)methanone (CID 130872132) is cyclopropyl(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)methanone.
What is the SMILES notation for cyclopropyl(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)methanone?
The canonical SMILES for cyclopropyl(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)methanone is O=C(C1CC1)N1Cc2cn[nH]c2C1.
What is the InChIKey of cyclopropyl(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)methanone?
The InChIKey is GYDGNCBUEIMOMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O/c13-9(6-1-2-6)12-4-7-3-10-11-8(7)5-12/h3,6H,1-2,4-5H2,(H,10,11).
What are the key properties of cyclopropyl(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)methanone?
cyclopropyl(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)methanone has a molecular weight of 177.21 g/mol, XLogP of 0.66, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)methanone is sourced from PubChem (CID 130872132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).