About 4-chloro-3-nonyloxane
4-chloro-3-nonyloxane (PubChem CID 13087293) has the molecular formula C14H27ClO
and a molecular weight of 246.82 g/mol. Its IUPAC name is 4-chloro-3-nonyloxane.
Molecular Properties
| Compound Name | 4-chloro-3-nonyloxane |
| PubChem CID | 13087293 |
| Molecular Formula | C14H27ClO |
| Molecular Weight | 246.82 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 4-chloro-3-nonyloxane |
| SMILES | CCCCCCCCCC1COCCC1Cl |
| InChI | InChI=1S/C14H27ClO/c1-2-3-4-5-6-7-8-9-13-12-16-11-10-14(13)15/h13-14H,2-12H2,1H3 |
| InChIKey | LXBONYHEZQPJLN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.82 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-nonyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-nonyloxane?
The IUPAC name of 4-chloro-3-nonyloxane (CID 13087293) is 4-chloro-3-nonyloxane.
What is the SMILES notation for 4-chloro-3-nonyloxane?
The canonical SMILES for 4-chloro-3-nonyloxane is CCCCCCCCCC1COCCC1Cl.
What is the InChIKey of 4-chloro-3-nonyloxane?
The InChIKey is LXBONYHEZQPJLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27ClO/c1-2-3-4-5-6-7-8-9-13-12-16-11-10-14(13)15/h13-14H,2-12H2,1H3.
What are the key properties of 4-chloro-3-nonyloxane?
4-chloro-3-nonyloxane has a molecular weight of 246.82 g/mol, XLogP of 4.77, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-nonyloxane is sourced from PubChem (CID 13087293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).