About 2,5-bis(butylsulfonylmethyl)-1,4-dioxane
2,5-bis(butylsulfonylmethyl)-1,4-dioxane (PubChem CID 13087304) has the molecular formula C14H28O6S2
and a molecular weight of 356.51 g/mol. Its IUPAC name is 2,5-bis(butylsulfonylmethyl)-1,4-dioxane.
Molecular Properties
| Compound Name | 2,5-bis(butylsulfonylmethyl)-1,4-dioxane |
| PubChem CID | 13087304 |
| Molecular Formula | C14H28O6S2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 2,5-bis(butylsulfonylmethyl)-1,4-dioxane |
| SMILES | CCCCS(=O)(=O)CC1COC(CS(=O)(=O)CCCC)CO1 |
| InChI | InChI=1S/C14H28O6S2/c1-3-5-7-21(15,16)11-13-9-20-14(10-19-13)12-22(17,18)8-6-4-2/h13-14H,3-12H2,1-2H3 |
| InChIKey | MTPCMJANNXZTIX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,5-bis(butylsulfonylmethyl)-1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(butylsulfonylmethyl)-1,4-dioxane?
The IUPAC name of 2,5-bis(butylsulfonylmethyl)-1,4-dioxane (CID 13087304) is 2,5-bis(butylsulfonylmethyl)-1,4-dioxane.
What is the SMILES notation for 2,5-bis(butylsulfonylmethyl)-1,4-dioxane?
The canonical SMILES for 2,5-bis(butylsulfonylmethyl)-1,4-dioxane is CCCCS(=O)(=O)CC1COC(CS(=O)(=O)CCCC)CO1.
What is the InChIKey of 2,5-bis(butylsulfonylmethyl)-1,4-dioxane?
The InChIKey is MTPCMJANNXZTIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O6S2/c1-3-5-7-21(15,16)11-13-9-20-14(10-19-13)12-22(17,18)8-6-4-2/h13-14H,3-12H2,1-2H3.
What are the key properties of 2,5-bis(butylsulfonylmethyl)-1,4-dioxane?
2,5-bis(butylsulfonylmethyl)-1,4-dioxane has a molecular weight of 356.51 g/mol, XLogP of 1.20, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(butylsulfonylmethyl)-1,4-dioxane is sourced from PubChem (CID 13087304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).