About N-(2-chloro-4,5-difluorophenyl)hydroxylamine
N-(2-chloro-4,5-difluorophenyl)hydroxylamine (PubChem CID 130873686) has the molecular formula C6H4ClF2NO
and a molecular weight of 179.55 g/mol. Its IUPAC name is N-(2-chloro-4,5-difluorophenyl)hydroxylamine.
Molecular Properties
| Compound Name | N-(2-chloro-4,5-difluorophenyl)hydroxylamine |
| PubChem CID | 130873686 |
| Molecular Formula | C6H4ClF2NO |
| Molecular Weight | 179.55 g/mol |
| Exact Mass | 178.99 |
| IUPAC Name | N-(2-chloro-4,5-difluorophenyl)hydroxylamine |
| SMILES | ONc1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C6H4ClF2NO/c7-3-1-4(8)5(9)2-6(3)10-11/h1-2,10-11H |
| InChIKey | DIEJQOLYLKOWOD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.55 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chloro-4,5-difluorophenyl)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloro-4,5-difluorophenyl)hydroxylamine?
The IUPAC name of N-(2-chloro-4,5-difluorophenyl)hydroxylamine (CID 130873686) is N-(2-chloro-4,5-difluorophenyl)hydroxylamine.
What is the SMILES notation for N-(2-chloro-4,5-difluorophenyl)hydroxylamine?
The canonical SMILES for N-(2-chloro-4,5-difluorophenyl)hydroxylamine is ONc1cc(F)c(F)cc1Cl.
What is the InChIKey of N-(2-chloro-4,5-difluorophenyl)hydroxylamine?
The InChIKey is DIEJQOLYLKOWOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClF2NO/c7-3-1-4(8)5(9)2-6(3)10-11/h1-2,10-11H.
What are the key properties of N-(2-chloro-4,5-difluorophenyl)hydroxylamine?
N-(2-chloro-4,5-difluorophenyl)hydroxylamine has a molecular weight of 179.55 g/mol, XLogP of 2.42, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloro-4,5-difluorophenyl)hydroxylamine is sourced from PubChem (CID 130873686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).