About 2-(benzylamino)-6,6-dimethylbicyclo[3.1.1]heptane-2-carbonitrile
2-(benzylamino)-6,6-dimethylbicyclo[3.1.1]heptane-2-carbonitrile (PubChem CID 130873725) has the molecular formula C17H22N2
and a molecular weight of 254.38 g/mol. Its IUPAC name is 2-(benzylamino)-6,6-dimethylbicyclo[3.1.1]heptane-2-carbonitrile.
Molecular Properties
| Compound Name | 2-(benzylamino)-6,6-dimethylbicyclo[3.1.1]heptane-2-carbonitrile |
| PubChem CID | 130873725 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 2-(benzylamino)-6,6-dimethylbicyclo[3.1.1]heptane-2-carbonitrile |
| SMILES | CC1(C)C2CCC(C#N)(NCc3ccccc3)C1C2 |
| InChI | InChI=1S/C17H22N2/c1-16(2)14-8-9-17(12-18,15(16)10-14)19-11-13-6-4-3-5-7-13/h3-7,14-15,19H,8-11H2,1-2H3 |
| InChIKey | ODMHZZPYYMELOI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(benzylamino)-6,6-dimethylbicyclo[3.1.1]heptane-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzylamino)-6,6-dimethylbicyclo[3.1.1]heptane-2-carbonitrile?
The IUPAC name of 2-(benzylamino)-6,6-dimethylbicyclo[3.1.1]heptane-2-carbonitrile (CID 130873725) is 2-(benzylamino)-6,6-dimethylbicyclo[3.1.1]heptane-2-carbonitrile.
What is the SMILES notation for 2-(benzylamino)-6,6-dimethylbicyclo[3.1.1]heptane-2-carbonitrile?
The canonical SMILES for 2-(benzylamino)-6,6-dimethylbicyclo[3.1.1]heptane-2-carbonitrile is CC1(C)C2CCC(C#N)(NCc3ccccc3)C1C2.
What is the InChIKey of 2-(benzylamino)-6,6-dimethylbicyclo[3.1.1]heptane-2-carbonitrile?
The InChIKey is ODMHZZPYYMELOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2/c1-16(2)14-8-9-17(12-18,15(16)10-14)19-11-13-6-4-3-5-7-13/h3-7,14-15,19H,8-11H2,1-2H3.
What are the key properties of 2-(benzylamino)-6,6-dimethylbicyclo[3.1.1]heptane-2-carbonitrile?
2-(benzylamino)-6,6-dimethylbicyclo[3.1.1]heptane-2-carbonitrile has a molecular weight of 254.38 g/mol, XLogP of 3.49, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzylamino)-6,6-dimethylbicyclo[3.1.1]heptane-2-carbonitrile is sourced from PubChem (CID 130873725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).