C9H17N3O — CID 130874740
2-(5-amino-2-azabicyclo[2.1.1]hexan-2-yl)-N-methylpropanamide (PubChem CID 130874740) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-(5-amino-2-azabicyclo[2.1.1]hexan-2-yl)-N-methylpropanamide.
| Compound Name | 2-(5-amino-2-azabicyclo[2.1.1]hexan-2-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 130874740 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 2-(5-amino-2-azabicyclo[2.1.1]hexan-2-yl)-N-methylpropanamide |
| SMILES | CNC(=O)C(C)N1CC2CC1C2N |
| InChI | InChI=1S/C9H17N3O/c1-5(9(13)11-2)12-4-6-3-7(12)8(6)10/h5-8H,3-4,10H2,1-2H3,(H,11,13) |
| InChIKey | FCTPJBKCVCXGAT-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |