About 2-amino-1,3-benzoxazole-6-thiol
2-amino-1,3-benzoxazole-6-thiol (PubChem CID 130877164) has the molecular formula C7H6N2OS
and a molecular weight of 166.21 g/mol. Its IUPAC name is 2-amino-1,3-benzoxazole-6-thiol.
Molecular Properties
| Compound Name | 2-amino-1,3-benzoxazole-6-thiol |
| PubChem CID | 130877164 |
| Molecular Formula | C7H6N2OS |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.02 |
| IUPAC Name | 2-amino-1,3-benzoxazole-6-thiol |
| SMILES | Nc1nc2ccc(S)cc2o1 |
| InChI | InChI=1S/C7H6N2OS/c8-7-9-5-2-1-4(11)3-6(5)10-7/h1-3,11H,(H2,8,9) |
| InChIKey | GWWPQNCGINKMNJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-1,3-benzoxazole-6-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1,3-benzoxazole-6-thiol?
The IUPAC name of 2-amino-1,3-benzoxazole-6-thiol (CID 130877164) is 2-amino-1,3-benzoxazole-6-thiol.
What is the SMILES notation for 2-amino-1,3-benzoxazole-6-thiol?
The canonical SMILES for 2-amino-1,3-benzoxazole-6-thiol is Nc1nc2ccc(S)cc2o1.
What is the InChIKey of 2-amino-1,3-benzoxazole-6-thiol?
The InChIKey is GWWPQNCGINKMNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2OS/c8-7-9-5-2-1-4(11)3-6(5)10-7/h1-3,11H,(H2,8,9).
What are the key properties of 2-amino-1,3-benzoxazole-6-thiol?
2-amino-1,3-benzoxazole-6-thiol has a molecular weight of 166.21 g/mol, XLogP of 1.70, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,3-benzoxazole-6-thiol is sourced from PubChem (CID 130877164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).