About 3-bromo-N-[(5-methyl-1,3-oxazol-4-yl)methyl]pyridin-2-amine
3-bromo-N-[(5-methyl-1,3-oxazol-4-yl)methyl]pyridin-2-amine (PubChem CID 130877519) has the molecular formula C10H10BrN3O
and a molecular weight of 268.11 g/mol. Its IUPAC name is 3-bromo-N-[(5-methyl-1,3-oxazol-4-yl)methyl]pyridin-2-amine.
Molecular Properties
| Compound Name | 3-bromo-N-[(5-methyl-1,3-oxazol-4-yl)methyl]pyridin-2-amine |
| PubChem CID | 130877519 |
| Molecular Formula | C10H10BrN3O |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 267.00 |
| IUPAC Name | 3-bromo-N-[(5-methyl-1,3-oxazol-4-yl)methyl]pyridin-2-amine |
| SMILES | Cc1ocnc1CNc1ncccc1Br |
| InChI | InChI=1S/C10H10BrN3O/c1-7-9(14-6-15-7)5-13-10-8(11)3-2-4-12-10/h2-4,6H,5H2,1H3,(H,12,13) |
| InChIKey | BLGGDICTJVAXFQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-N-[(5-methyl-1,3-oxazol-4-yl)methyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-[(5-methyl-1,3-oxazol-4-yl)methyl]pyridin-2-amine?
The IUPAC name of 3-bromo-N-[(5-methyl-1,3-oxazol-4-yl)methyl]pyridin-2-amine (CID 130877519) is 3-bromo-N-[(5-methyl-1,3-oxazol-4-yl)methyl]pyridin-2-amine.
What is the SMILES notation for 3-bromo-N-[(5-methyl-1,3-oxazol-4-yl)methyl]pyridin-2-amine?
The canonical SMILES for 3-bromo-N-[(5-methyl-1,3-oxazol-4-yl)methyl]pyridin-2-amine is Cc1ocnc1CNc1ncccc1Br.
What is the InChIKey of 3-bromo-N-[(5-methyl-1,3-oxazol-4-yl)methyl]pyridin-2-amine?
The InChIKey is BLGGDICTJVAXFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrN3O/c1-7-9(14-6-15-7)5-13-10-8(11)3-2-4-12-10/h2-4,6H,5H2,1H3,(H,12,13).
What are the key properties of 3-bromo-N-[(5-methyl-1,3-oxazol-4-yl)methyl]pyridin-2-amine?
3-bromo-N-[(5-methyl-1,3-oxazol-4-yl)methyl]pyridin-2-amine has a molecular weight of 268.11 g/mol, XLogP of 2.75, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-[(5-methyl-1,3-oxazol-4-yl)methyl]pyridin-2-amine is sourced from PubChem (CID 130877519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).