C9H16O2 — CID 130877530
(1S,2S,4S)-2-(2-hydroxyethyl)bicyclo[2.2.1]heptan-2-ol (PubChem CID 130877530) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is (1S,2S,4S)-2-(2-hydroxyethyl)bicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1S,2S,4S)-2-(2-hydroxyethyl)bicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 130877530 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (1S,2S,4S)-2-(2-hydroxyethyl)bicyclo[2.2.1]heptan-2-ol |
| SMILES | OCC[C@@]1(O)C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C9H16O2/c10-4-3-9(11)6-7-1-2-8(9)5-7/h7-8,10-11H,1-6H2/t7-,8-,9+/m0/s1 |
| InChIKey | VJRJZWQCXFZQAS-XHNCKOQMSA-N |
| XLogP | 0.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |