C11H14N2O2 — CID 130877844
1-[(3-methyl-4-pyridinyl)methyl]azetidine-3-carboxylic acid (PubChem CID 130877844) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 1-[(3-methyl-4-pyridinyl)methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[(3-methyl-4-pyridinyl)methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 130877844 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-[(3-methyl-4-pyridinyl)methyl]azetidine-3-carboxylic acid |
| SMILES | Cc1cnccc1CN1CC(C(=O)O)C1 |
| InChI | InChI=1S/C11H14N2O2/c1-8-4-12-3-2-9(8)5-13-6-10(7-13)11(14)15/h2-4,10H,5-7H2,1H3,(H,14,15) |
| InChIKey | MBBMNWZNMRCFBC-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |