C9H20N4O — CID 130877853
1-[1-(2-hydroxyethyl)piperidin-3-yl]-2-methylguanidine (PubChem CID 130877853) has the molecular formula C9H20N4O and a molecular weight of 200.29 g/mol. Its IUPAC name is 1-[1-(2-hydroxyethyl)piperidin-3-yl]-2-methylguanidine.
| Compound Name | 1-[1-(2-hydroxyethyl)piperidin-3-yl]-2-methylguanidine |
|---|---|
| PubChem CID | 130877853 |
| Molecular Formula | C9H20N4O |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 1-[1-(2-hydroxyethyl)piperidin-3-yl]-2-methylguanidine |
| SMILES | C/N=C(\N)NC1CCCN(CCO)C1 |
| InChI | InChI=1S/C9H20N4O/c1-11-9(10)12-8-3-2-4-13(7-8)5-6-14/h8,14H,2-7H2,1H3,(H3,10,11,12) |
| InChIKey | YSFKWIRWDZYTJZ-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|