About 6-methyloxane-2,4-dione
6-methyloxane-2,4-dione (PubChem CID 13087874) has the molecular formula C6H8O3
and a molecular weight of 128.13 g/mol. Its IUPAC name is 6-methyloxane-2,4-dione.
Molecular Properties
| Compound Name | 6-methyloxane-2,4-dione |
| PubChem CID | 13087874 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | 6-methyloxane-2,4-dione |
| SMILES | CC1CC(=O)CC(=O)O1 |
| InChI | InChI=1S/C6H8O3/c1-4-2-5(7)3-6(8)9-4/h4H,2-3H2,1H3 |
| InChIKey | UUVIHKCBKAOTEW-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 6-methyloxane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyloxane-2,4-dione?
The IUPAC name of 6-methyloxane-2,4-dione (CID 13087874) is 6-methyloxane-2,4-dione.
What is the SMILES notation for 6-methyloxane-2,4-dione?
The canonical SMILES for 6-methyloxane-2,4-dione is CC1CC(=O)CC(=O)O1.
What is the InChIKey of 6-methyloxane-2,4-dione?
The InChIKey is UUVIHKCBKAOTEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O3/c1-4-2-5(7)3-6(8)9-4/h4H,2-3H2,1H3.
What are the key properties of 6-methyloxane-2,4-dione?
6-methyloxane-2,4-dione has a molecular weight of 128.13 g/mol, XLogP of 0.28, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyloxane-2,4-dione is sourced from PubChem (CID 13087874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).