About 5,5-dimethylcyclohexane-1,2,3-trione
5,5-dimethylcyclohexane-1,2,3-trione (PubChem CID 13087891) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is 5,5-dimethylcyclohexane-1,2,3-trione.
Molecular Properties
| Compound Name | 5,5-dimethylcyclohexane-1,2,3-trione |
| PubChem CID | 13087891 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 5,5-dimethylcyclohexane-1,2,3-trione |
| SMILES | CC1(C)CC(=O)C(=O)C(=O)C1 |
| InChI | InChI=1S/C8H10O3/c1-8(2)3-5(9)7(11)6(10)4-8/h3-4H2,1-2H3 |
| InChIKey | FZGNLVJTHFPHAX-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethylcyclohexane-1,2,3-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethylcyclohexane-1,2,3-trione?
The IUPAC name of 5,5-dimethylcyclohexane-1,2,3-trione (CID 13087891) is 5,5-dimethylcyclohexane-1,2,3-trione.
What is the SMILES notation for 5,5-dimethylcyclohexane-1,2,3-trione?
The canonical SMILES for 5,5-dimethylcyclohexane-1,2,3-trione is CC1(C)CC(=O)C(=O)C(=O)C1.
What is the InChIKey of 5,5-dimethylcyclohexane-1,2,3-trione?
The InChIKey is FZGNLVJTHFPHAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c1-8(2)3-5(9)7(11)6(10)4-8/h3-4H2,1-2H3.
What are the key properties of 5,5-dimethylcyclohexane-1,2,3-trione?
5,5-dimethylcyclohexane-1,2,3-trione has a molecular weight of 154.16 g/mol, XLogP of 0.51, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethylcyclohexane-1,2,3-trione is sourced from PubChem (CID 13087891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).