About (3aS,7aR)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-3-one
(3aS,7aR)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-3-one (PubChem CID 130879279) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is (3aS,7aR)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-3-one.
Analyze (3aS,7aR)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3aS,7aR)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-3-one?
The IUPAC name of (3aS,7aR)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-3-one (CID 130879279) is (3aS,7aR)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-3-one.
What is the SMILES notation for (3aS,7aR)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-3-one?
The canonical SMILES for (3aS,7aR)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-3-one is O=C1CO[C@@H]2CCCC[C@H]12.
What is the InChIKey of (3aS,7aR)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-3-one?
The InChIKey is FDJMYPDRQZWUDG-HTRCEHHLSA-N. The full InChI is InChI=1S/C8H12O2/c9-7-5-10-8-4-2-1-3-6(7)8/h6,8H,1-5H2/t6-,8-/m1/s1.
What are the key properties of (3aS,7aR)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-3-one?
(3aS,7aR)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-3-one has a molecular weight of 140.18 g/mol, XLogP of 1.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3aS,7aR)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-3-one is sourced from PubChem (CID 130879279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).