About 2-benzyl-4-bromoaniline
2-benzyl-4-bromoaniline (PubChem CID 13088095) has the molecular formula C13H12BrN
and a molecular weight of 262.15 g/mol. Its IUPAC name is 2-benzyl-4-bromoaniline.
Molecular Properties
| Compound Name | 2-benzyl-4-bromoaniline |
| PubChem CID | 13088095 |
| Molecular Formula | C13H12BrN |
| Molecular Weight | 262.15 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 2-benzyl-4-bromoaniline |
| SMILES | Nc1ccc(Br)cc1Cc1ccccc1 |
| InChI | InChI=1S/C13H12BrN/c14-12-6-7-13(15)11(9-12)8-10-4-2-1-3-5-10/h1-7,9H,8,15H2 |
| InChIKey | ZIADYBWNQHGRTB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.15 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-4-bromoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-4-bromoaniline?
The IUPAC name of 2-benzyl-4-bromoaniline (CID 13088095) is 2-benzyl-4-bromoaniline.
What is the SMILES notation for 2-benzyl-4-bromoaniline?
The canonical SMILES for 2-benzyl-4-bromoaniline is Nc1ccc(Br)cc1Cc1ccccc1.
What is the InChIKey of 2-benzyl-4-bromoaniline?
The InChIKey is ZIADYBWNQHGRTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrN/c14-12-6-7-13(15)11(9-12)8-10-4-2-1-3-5-10/h1-7,9H,8,15H2.
What are the key properties of 2-benzyl-4-bromoaniline?
2-benzyl-4-bromoaniline has a molecular weight of 262.15 g/mol, XLogP of 3.62, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-4-bromoaniline is sourced from PubChem (CID 13088095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).