About 2-(1H-indol-3-yl)-7,8-dihydro-6H-quinolin-5-one
2-(1H-indol-3-yl)-7,8-dihydro-6H-quinolin-5-one (PubChem CID 13088239) has the molecular formula C17H14N2O
and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-7,8-dihydro-6H-quinolin-5-one.
Molecular Properties
| Compound Name | 2-(1H-indol-3-yl)-7,8-dihydro-6H-quinolin-5-one |
| PubChem CID | 13088239 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 2-(1H-indol-3-yl)-7,8-dihydro-6H-quinolin-5-one |
| SMILES | O=C1CCCc2nc(-c3c[nH]c4ccccc34)ccc21 |
| InChI | InChI=1S/C17H14N2O/c20-17-7-3-6-15-12(17)8-9-16(19-15)13-10-18-14-5-2-1-4-11(13)14/h1-2,4-5,8-10,18H,3,6-7H2 |
| InChIKey | HBQAXIHBNORJBP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1H-indol-3-yl)-7,8-dihydro-6H-quinolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-indol-3-yl)-7,8-dihydro-6H-quinolin-5-one?
The IUPAC name of 2-(1H-indol-3-yl)-7,8-dihydro-6H-quinolin-5-one (CID 13088239) is 2-(1H-indol-3-yl)-7,8-dihydro-6H-quinolin-5-one.
What is the SMILES notation for 2-(1H-indol-3-yl)-7,8-dihydro-6H-quinolin-5-one?
The canonical SMILES for 2-(1H-indol-3-yl)-7,8-dihydro-6H-quinolin-5-one is O=C1CCCc2nc(-c3c[nH]c4ccccc34)ccc21.
What is the InChIKey of 2-(1H-indol-3-yl)-7,8-dihydro-6H-quinolin-5-one?
The InChIKey is HBQAXIHBNORJBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O/c20-17-7-3-6-15-12(17)8-9-16(19-15)13-10-18-14-5-2-1-4-11(13)14/h1-2,4-5,8-10,18H,3,6-7H2.
What are the key properties of 2-(1H-indol-3-yl)-7,8-dihydro-6H-quinolin-5-one?
2-(1H-indol-3-yl)-7,8-dihydro-6H-quinolin-5-one has a molecular weight of 262.31 g/mol, XLogP of 3.75, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-indol-3-yl)-7,8-dihydro-6H-quinolin-5-one is sourced from PubChem (CID 13088239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).