About 4-(difluoromethyl)-1-benzothiophene-6,7-diamine
4-(difluoromethyl)-1-benzothiophene-6,7-diamine (PubChem CID 130884046) has the molecular formula C9H8F2N2S
and a molecular weight of 214.24 g/mol. Its IUPAC name is 4-(difluoromethyl)-1-benzothiophene-6,7-diamine.
Molecular Properties
| Compound Name | 4-(difluoromethyl)-1-benzothiophene-6,7-diamine |
| PubChem CID | 130884046 |
| Molecular Formula | C9H8F2N2S |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 4-(difluoromethyl)-1-benzothiophene-6,7-diamine |
| SMILES | Nc1cc(C(F)F)c2ccsc2c1N |
| InChI | InChI=1S/C9H8F2N2S/c10-9(11)5-3-6(12)7(13)8-4(5)1-2-14-8/h1-3,9H,12-13H2 |
| InChIKey | UDQDEXUNLLLSDD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(difluoromethyl)-1-benzothiophene-6,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethyl)-1-benzothiophene-6,7-diamine?
The IUPAC name of 4-(difluoromethyl)-1-benzothiophene-6,7-diamine (CID 130884046) is 4-(difluoromethyl)-1-benzothiophene-6,7-diamine.
What is the SMILES notation for 4-(difluoromethyl)-1-benzothiophene-6,7-diamine?
The canonical SMILES for 4-(difluoromethyl)-1-benzothiophene-6,7-diamine is Nc1cc(C(F)F)c2ccsc2c1N.
What is the InChIKey of 4-(difluoromethyl)-1-benzothiophene-6,7-diamine?
The InChIKey is UDQDEXUNLLLSDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F2N2S/c10-9(11)5-3-6(12)7(13)8-4(5)1-2-14-8/h1-3,9H,12-13H2.
What are the key properties of 4-(difluoromethyl)-1-benzothiophene-6,7-diamine?
4-(difluoromethyl)-1-benzothiophene-6,7-diamine has a molecular weight of 214.24 g/mol, XLogP of 3.00, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethyl)-1-benzothiophene-6,7-diamine is sourced from PubChem (CID 130884046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).