About 2,2-dimethyloxasilepane
2,2-dimethyloxasilepane (PubChem CID 13088411) has the molecular formula C7H16OSi
and a molecular weight of 144.29 g/mol. Its IUPAC name is 2,2-dimethyloxasilepane.
Molecular Properties
| Compound Name | 2,2-dimethyloxasilepane |
| PubChem CID | 13088411 |
| Molecular Formula | C7H16OSi |
| Molecular Weight | 144.29 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | 2,2-dimethyloxasilepane |
| SMILES | C[Si]1(C)CCCCCO1 |
| InChI | InChI=1S/C7H16OSi/c1-9(2)7-5-3-4-6-8-9/h3-7H2,1-2H3 |
| InChIKey | DWPHIOWJFTXEMM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyloxasilepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyloxasilepane?
The IUPAC name of 2,2-dimethyloxasilepane (CID 13088411) is 2,2-dimethyloxasilepane.
What is the SMILES notation for 2,2-dimethyloxasilepane?
The canonical SMILES for 2,2-dimethyloxasilepane is C[Si]1(C)CCCCCO1.
What is the InChIKey of 2,2-dimethyloxasilepane?
The InChIKey is DWPHIOWJFTXEMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16OSi/c1-9(2)7-5-3-4-6-8-9/h3-7H2,1-2H3.
What are the key properties of 2,2-dimethyloxasilepane?
2,2-dimethyloxasilepane has a molecular weight of 144.29 g/mol, XLogP of 2.39, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyloxasilepane is sourced from PubChem (CID 13088411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).