About N-(3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide
N-(3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide (PubChem CID 130885149) has the molecular formula C9H17F2NO
and a molecular weight of 193.24 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide.
Molecular Properties
| Compound Name | N-(3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide |
| PubChem CID | 130885149 |
| Molecular Formula | C9H17F2NO |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide |
| SMILES | CC(NC(=O)C(C)(F)F)C(C)(C)C |
| InChI | InChI=1S/C9H17F2NO/c1-6(8(2,3)4)12-7(13)9(5,10)11/h6H,1-5H3,(H,12,13) |
| InChIKey | UGWUTSIDWZRRBH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide?
The IUPAC name of N-(3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide (CID 130885149) is N-(3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide.
What is the SMILES notation for N-(3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide?
The canonical SMILES for N-(3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide is CC(NC(=O)C(C)(F)F)C(C)(C)C.
What is the InChIKey of N-(3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide?
The InChIKey is UGWUTSIDWZRRBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2NO/c1-6(8(2,3)4)12-7(13)9(5,10)11/h6H,1-5H3,(H,12,13).
What are the key properties of N-(3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide?
N-(3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide has a molecular weight of 193.24 g/mol, XLogP of 2.19, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide is sourced from PubChem (CID 130885149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).