About (3,3-dimethyl-5-methylsulfonyloxy-2H-1-benzofuran-2-yl) 2-methylpropanoate
(3,3-dimethyl-5-methylsulfonyloxy-2H-1-benzofuran-2-yl) 2-methylpropanoate (PubChem CID 13088531) has the molecular formula C15H20O6S
and a molecular weight of 328.39 g/mol. Its IUPAC name is (3,3-dimethyl-5-methylsulfonyloxy-2H-1-benzofuran-2-yl) 2-methylpropanoate.
Molecular Properties
| Compound Name | (3,3-dimethyl-5-methylsulfonyloxy-2H-1-benzofuran-2-yl) 2-methylpropanoate |
| PubChem CID | 13088531 |
| Molecular Formula | C15H20O6S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | (3,3-dimethyl-5-methylsulfonyloxy-2H-1-benzofuran-2-yl) 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC1Oc2ccc(OS(C)(=O)=O)cc2C1(C)C |
| InChI | InChI=1S/C15H20O6S/c1-9(2)13(16)20-14-15(3,4)11-8-10(21-22(5,17)18)6-7-12(11)19-14/h6-9,14H,1-5H3 |
| InChIKey | MJZZRBWRDQLBRC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3,3-dimethyl-5-methylsulfonyloxy-2H-1-benzofuran-2-yl) 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-dimethyl-5-methylsulfonyloxy-2H-1-benzofuran-2-yl) 2-methylpropanoate?
The IUPAC name of (3,3-dimethyl-5-methylsulfonyloxy-2H-1-benzofuran-2-yl) 2-methylpropanoate (CID 13088531) is (3,3-dimethyl-5-methylsulfonyloxy-2H-1-benzofuran-2-yl) 2-methylpropanoate.
What is the SMILES notation for (3,3-dimethyl-5-methylsulfonyloxy-2H-1-benzofuran-2-yl) 2-methylpropanoate?
The canonical SMILES for (3,3-dimethyl-5-methylsulfonyloxy-2H-1-benzofuran-2-yl) 2-methylpropanoate is CC(C)C(=O)OC1Oc2ccc(OS(C)(=O)=O)cc2C1(C)C.
What is the InChIKey of (3,3-dimethyl-5-methylsulfonyloxy-2H-1-benzofuran-2-yl) 2-methylpropanoate?
The InChIKey is MJZZRBWRDQLBRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O6S/c1-9(2)13(16)20-14-15(3,4)11-8-10(21-22(5,17)18)6-7-12(11)19-14/h6-9,14H,1-5H3.
What are the key properties of (3,3-dimethyl-5-methylsulfonyloxy-2H-1-benzofuran-2-yl) 2-methylpropanoate?
(3,3-dimethyl-5-methylsulfonyloxy-2H-1-benzofuran-2-yl) 2-methylpropanoate has a molecular weight of 328.39 g/mol, XLogP of 2.22, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dimethyl-5-methylsulfonyloxy-2H-1-benzofuran-2-yl) 2-methylpropanoate is sourced from PubChem (CID 13088531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).