About (4R,7S)-2,4-dimethyl-7-propan-2-ylazepane
(4R,7S)-2,4-dimethyl-7-propan-2-ylazepane (PubChem CID 130888278) has the molecular formula C11H23N
and a molecular weight of 169.31 g/mol. Its IUPAC name is (4R,7S)-2,4-dimethyl-7-propan-2-ylazepane.
Molecular Properties
| Compound Name | (4R,7S)-2,4-dimethyl-7-propan-2-ylazepane |
| PubChem CID | 130888278 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | (4R,7S)-2,4-dimethyl-7-propan-2-ylazepane |
| SMILES | CC1C[C@H](C)CC[C@@H](C(C)C)N1 |
| InChI | InChI=1S/C11H23N/c1-8(2)11-6-5-9(3)7-10(4)12-11/h8-12H,5-7H2,1-4H3/t9-,10?,11+/m1/s1 |
| InChIKey | JXXURRAFYCVEFB-FBKFWFMHSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4R,7S)-2,4-dimethyl-7-propan-2-ylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,7S)-2,4-dimethyl-7-propan-2-ylazepane?
The IUPAC name of (4R,7S)-2,4-dimethyl-7-propan-2-ylazepane (CID 130888278) is (4R,7S)-2,4-dimethyl-7-propan-2-ylazepane.
What is the SMILES notation for (4R,7S)-2,4-dimethyl-7-propan-2-ylazepane?
The canonical SMILES for (4R,7S)-2,4-dimethyl-7-propan-2-ylazepane is CC1C[C@H](C)CC[C@@H](C(C)C)N1.
What is the InChIKey of (4R,7S)-2,4-dimethyl-7-propan-2-ylazepane?
The InChIKey is JXXURRAFYCVEFB-FBKFWFMHSA-N. The full InChI is InChI=1S/C11H23N/c1-8(2)11-6-5-9(3)7-10(4)12-11/h8-12H,5-7H2,1-4H3/t9-,10?,11+/m1/s1.
What are the key properties of (4R,7S)-2,4-dimethyl-7-propan-2-ylazepane?
(4R,7S)-2,4-dimethyl-7-propan-2-ylazepane has a molecular weight of 169.31 g/mol, XLogP of 2.81, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,7S)-2,4-dimethyl-7-propan-2-ylazepane is sourced from PubChem (CID 130888278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).