About (4-bromo-1,3-dimethylpyrazol-5-yl)urea
(4-bromo-1,3-dimethylpyrazol-5-yl)urea (PubChem CID 130890934) has the molecular formula C6H9BrN4O
and a molecular weight of 233.07 g/mol. Its IUPAC name is (4-bromo-1,3-dimethylpyrazol-5-yl)urea.
Molecular Properties
| Compound Name | (4-bromo-1,3-dimethylpyrazol-5-yl)urea |
| PubChem CID | 130890934 |
| Molecular Formula | C6H9BrN4O |
| Molecular Weight | 233.07 g/mol |
| Exact Mass | 232.00 |
| IUPAC Name | (4-bromo-1,3-dimethylpyrazol-5-yl)urea |
| SMILES | Cc1nn(C)c(NC(N)=O)c1Br |
| InChI | InChI=1S/C6H9BrN4O/c1-3-4(7)5(9-6(8)12)11(2)10-3/h1-2H3,(H3,8,9,12) |
| InChIKey | FUDNTZPIMYHEMM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.07 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-bromo-1,3-dimethylpyrazol-5-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-1,3-dimethylpyrazol-5-yl)urea?
The IUPAC name of (4-bromo-1,3-dimethylpyrazol-5-yl)urea (CID 130890934) is (4-bromo-1,3-dimethylpyrazol-5-yl)urea.
What is the SMILES notation for (4-bromo-1,3-dimethylpyrazol-5-yl)urea?
The canonical SMILES for (4-bromo-1,3-dimethylpyrazol-5-yl)urea is Cc1nn(C)c(NC(N)=O)c1Br.
What is the InChIKey of (4-bromo-1,3-dimethylpyrazol-5-yl)urea?
The InChIKey is FUDNTZPIMYHEMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrN4O/c1-3-4(7)5(9-6(8)12)11(2)10-3/h1-2H3,(H3,8,9,12).
What are the key properties of (4-bromo-1,3-dimethylpyrazol-5-yl)urea?
(4-bromo-1,3-dimethylpyrazol-5-yl)urea has a molecular weight of 233.07 g/mol, XLogP of 0.98, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-1,3-dimethylpyrazol-5-yl)urea is sourced from PubChem (CID 130890934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).