About N'-prop-2-enylpyrrolidine-1-carboximidamide;hydroiodide
N'-prop-2-enylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 130890940) has the molecular formula C8H16IN3
and a molecular weight of 281.14 g/mol. Its IUPAC name is N'-prop-2-enylpyrrolidine-1-carboximidamide;hydroiodide.
Molecular Properties
| Compound Name | N'-prop-2-enylpyrrolidine-1-carboximidamide;hydroiodide |
| PubChem CID | 130890940 |
| Molecular Formula | C8H16IN3 |
| Molecular Weight | 281.14 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | N'-prop-2-enylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C=CC/N=C(\N)N1CCCC1.I |
| InChI | InChI=1S/C8H15N3.HI/c1-2-5-10-8(9)11-6-3-4-7-11;/h2H,1,3-7H2,(H2,9,10);1H |
| InChIKey | CXEBXBGJBJXQQE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.14 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-prop-2-enylpyrrolidine-1-carboximidamide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-prop-2-enylpyrrolidine-1-carboximidamide;hydroiodide?
The IUPAC name of N'-prop-2-enylpyrrolidine-1-carboximidamide;hydroiodide (CID 130890940) is N'-prop-2-enylpyrrolidine-1-carboximidamide;hydroiodide.
What is the SMILES notation for N'-prop-2-enylpyrrolidine-1-carboximidamide;hydroiodide?
The canonical SMILES for N'-prop-2-enylpyrrolidine-1-carboximidamide;hydroiodide is C=CC/N=C(\N)N1CCCC1.I.
What is the InChIKey of N'-prop-2-enylpyrrolidine-1-carboximidamide;hydroiodide?
The InChIKey is CXEBXBGJBJXQQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3.HI/c1-2-5-10-8(9)11-6-3-4-7-11;/h2H,1,3-7H2,(H2,9,10);1H.
What are the key properties of N'-prop-2-enylpyrrolidine-1-carboximidamide;hydroiodide?
N'-prop-2-enylpyrrolidine-1-carboximidamide;hydroiodide has a molecular weight of 281.14 g/mol, XLogP of 1.20, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-prop-2-enylpyrrolidine-1-carboximidamide;hydroiodide is sourced from PubChem (CID 130890940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).