2-(2,2-dimethylazetidin-1-yl)acetic acid

C7H13NO2 — CID 130891071

IUPAC2-(2,2-dimethylazetidin-1-yl)acetic acid
SMILESCC1(C)CCN1CC(=O)O
InChIInChI=1S/C7H13NO2/c1-7(2)3-4-8(7)5-6(9)10/h3-5H2,1-2H3,(H,9,10)
InChIKeyZPXDGCWTQRRSEX-UHFFFAOYSA-N
MW143.19 g/mol
LogP0.56
Rot. Bonds2

About 2-(2,2-dimethylazetidin-1-yl)acetic acid

2-(2,2-dimethylazetidin-1-yl)acetic acid (PubChem CID 130891071) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is 2-(2,2-dimethylazetidin-1-yl)acetic acid.

Molecular Properties

Compound Name2-(2,2-dimethylazetidin-1-yl)acetic acid
PubChem CID130891071
Molecular FormulaC7H13NO2
Molecular Weight143.19 g/mol
Exact Mass143.09
IUPAC Name2-(2,2-dimethylazetidin-1-yl)acetic acid
SMILESCC1(C)CCN1CC(=O)O
InChIInChI=1S/C7H13NO2/c1-7(2)3-4-8(7)5-6(9)10/h3-5H2,1-2H3,(H,9,10)
InChIKeyZPXDGCWTQRRSEX-UHFFFAOYSA-N
XLogP0.56
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500143.19
LogP ≤ 50.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(2,2-dimethylazetidin-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2-dimethylazetidin-1-yl)acetic acid?
The IUPAC name of 2-(2,2-dimethylazetidin-1-yl)acetic acid (CID 130891071) is 2-(2,2-dimethylazetidin-1-yl)acetic acid.
What is the SMILES notation for 2-(2,2-dimethylazetidin-1-yl)acetic acid?
The canonical SMILES for 2-(2,2-dimethylazetidin-1-yl)acetic acid is CC1(C)CCN1CC(=O)O.
What is the InChIKey of 2-(2,2-dimethylazetidin-1-yl)acetic acid?
The InChIKey is ZPXDGCWTQRRSEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c1-7(2)3-4-8(7)5-6(9)10/h3-5H2,1-2H3,(H,9,10).
What are the key properties of 2-(2,2-dimethylazetidin-1-yl)acetic acid?
2-(2,2-dimethylazetidin-1-yl)acetic acid has a molecular weight of 143.19 g/mol, XLogP of 0.56, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylazetidin-1-yl)acetic acid is sourced from PubChem (CID 130891071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).