C10H18O3 — CID 130891192
(2S,4S)-4-hydroxy-5,5-dimethyl-2-propyloxan-3-one (PubChem CID 130891192) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (2S,4S)-4-hydroxy-5,5-dimethyl-2-propyloxan-3-one.
| Compound Name | (2S,4S)-4-hydroxy-5,5-dimethyl-2-propyloxan-3-one |
|---|---|
| PubChem CID | 130891192 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (2S,4S)-4-hydroxy-5,5-dimethyl-2-propyloxan-3-one |
| SMILES | CCC[C@@H]1OCC(C)(C)[C@H](O)C1=O |
| InChI | InChI=1S/C10H18O3/c1-4-5-7-8(11)9(12)10(2,3)6-13-7/h7,9,12H,4-6H2,1-3H3/t7-,9+/m0/s1 |
| InChIKey | HWRCTGMBJFPCCC-IONNQARKSA-N |
| XLogP | 1.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |