About (2S,4S)-4-hydroxy-5,5-dimethyl-2-propyloxan-3-one
(2S,4S)-4-hydroxy-5,5-dimethyl-2-propyloxan-3-one (PubChem CID 130891192) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is (2S,4S)-4-hydroxy-5,5-dimethyl-2-propyloxan-3-one.
Molecular Properties
| Compound Name | (2S,4S)-4-hydroxy-5,5-dimethyl-2-propyloxan-3-one |
| PubChem CID | 130891192 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (2S,4S)-4-hydroxy-5,5-dimethyl-2-propyloxan-3-one |
| SMILES | CCC[C@@H]1OCC(C)(C)[C@H](O)C1=O |
| InChI | InChI=1S/C10H18O3/c1-4-5-7-8(11)9(12)10(2,3)6-13-7/h7,9,12H,4-6H2,1-3H3/t7-,9+/m0/s1 |
| InChIKey | HWRCTGMBJFPCCC-IONNQARKSA-N |
| XLogP | 1.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,4S)-4-hydroxy-5,5-dimethyl-2-propyloxan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4S)-4-hydroxy-5,5-dimethyl-2-propyloxan-3-one?
The IUPAC name of (2S,4S)-4-hydroxy-5,5-dimethyl-2-propyloxan-3-one (CID 130891192) is (2S,4S)-4-hydroxy-5,5-dimethyl-2-propyloxan-3-one.
What is the SMILES notation for (2S,4S)-4-hydroxy-5,5-dimethyl-2-propyloxan-3-one?
The canonical SMILES for (2S,4S)-4-hydroxy-5,5-dimethyl-2-propyloxan-3-one is CCC[C@@H]1OCC(C)(C)[C@H](O)C1=O.
What is the InChIKey of (2S,4S)-4-hydroxy-5,5-dimethyl-2-propyloxan-3-one?
The InChIKey is HWRCTGMBJFPCCC-IONNQARKSA-N. The full InChI is InChI=1S/C10H18O3/c1-4-5-7-8(11)9(12)10(2,3)6-13-7/h7,9,12H,4-6H2,1-3H3/t7-,9+/m0/s1.
What are the key properties of (2S,4S)-4-hydroxy-5,5-dimethyl-2-propyloxan-3-one?
(2S,4S)-4-hydroxy-5,5-dimethyl-2-propyloxan-3-one has a molecular weight of 186.25 g/mol, XLogP of 1.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S)-4-hydroxy-5,5-dimethyl-2-propyloxan-3-one is sourced from PubChem (CID 130891192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).