C10H16O2 — CID 130891301
(1R,5R,6S)-2-(hydroxymethyl)-7,7-dimethylbicyclo[3.1.1]hept-2-en-6-ol (PubChem CID 130891301) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (1R,5R,6S)-2-(hydroxymethyl)-7,7-dimethylbicyclo[3.1.1]hept-2-en-6-ol.
| Compound Name | (1R,5R,6S)-2-(hydroxymethyl)-7,7-dimethylbicyclo[3.1.1]hept-2-en-6-ol |
|---|---|
| PubChem CID | 130891301 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (1R,5R,6S)-2-(hydroxymethyl)-7,7-dimethylbicyclo[3.1.1]hept-2-en-6-ol |
| SMILES | CC1(C)[C@@H]2C(CO)=CC[C@H]1[C@@H]2O |
| InChI | InChI=1S/C10H16O2/c1-10(2)7-4-3-6(5-11)8(10)9(7)12/h3,7-9,11-12H,4-5H2,1-2H3/t7-,8+,9-/m0/s1 |
| InChIKey | WGBYBEXDMHHOOW-YIZRAAEISA-N |
| XLogP | 0.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|