About [(1R,2R)-2-[(3,6-dichloro-2-pyridinyl)amino]cyclopropyl]methanol
[(1R,2R)-2-[(3,6-dichloro-2-pyridinyl)amino]cyclopropyl]methanol (PubChem CID 130891384) has the molecular formula C9H10Cl2N2O
and a molecular weight of 233.10 g/mol. Its IUPAC name is [(1R,2R)-2-[(3,6-dichloro-2-pyridinyl)amino]cyclopropyl]methanol.
Molecular Properties
| Compound Name | [(1R,2R)-2-[(3,6-dichloro-2-pyridinyl)amino]cyclopropyl]methanol |
| PubChem CID | 130891384 |
| Molecular Formula | C9H10Cl2N2O |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | [(1R,2R)-2-[(3,6-dichloro-2-pyridinyl)amino]cyclopropyl]methanol |
| SMILES | OC[C@@H]1C[C@H]1Nc1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H10Cl2N2O/c10-6-1-2-8(11)13-9(6)12-7-3-5(7)4-14/h1-2,5,7,14H,3-4H2,(H,12,13)/t5-,7+/m0/s1 |
| InChIKey | KAIOAJIGLNWWHX-CAHLUQPWSA-N |
| XLogP | 2.18 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2R)-2-[(3,6-dichloro-2-pyridinyl)amino]cyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-2-[(3,6-dichloro-2-pyridinyl)amino]cyclopropyl]methanol?
The IUPAC name of [(1R,2R)-2-[(3,6-dichloro-2-pyridinyl)amino]cyclopropyl]methanol (CID 130891384) is [(1R,2R)-2-[(3,6-dichloro-2-pyridinyl)amino]cyclopropyl]methanol.
What is the SMILES notation for [(1R,2R)-2-[(3,6-dichloro-2-pyridinyl)amino]cyclopropyl]methanol?
The canonical SMILES for [(1R,2R)-2-[(3,6-dichloro-2-pyridinyl)amino]cyclopropyl]methanol is OC[C@@H]1C[C@H]1Nc1nc(Cl)ccc1Cl.
What is the InChIKey of [(1R,2R)-2-[(3,6-dichloro-2-pyridinyl)amino]cyclopropyl]methanol?
The InChIKey is KAIOAJIGLNWWHX-CAHLUQPWSA-N. The full InChI is InChI=1S/C9H10Cl2N2O/c10-6-1-2-8(11)13-9(6)12-7-3-5(7)4-14/h1-2,5,7,14H,3-4H2,(H,12,13)/t5-,7+/m0/s1.
What are the key properties of [(1R,2R)-2-[(3,6-dichloro-2-pyridinyl)amino]cyclopropyl]methanol?
[(1R,2R)-2-[(3,6-dichloro-2-pyridinyl)amino]cyclopropyl]methanol has a molecular weight of 233.10 g/mol, XLogP of 2.18, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-[(3,6-dichloro-2-pyridinyl)amino]cyclopropyl]methanol is sourced from PubChem (CID 130891384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).