C9H7F2NO2 — CID 130891966
2,2-difluoro-6,7-dihydro-5H-[1,3]dioxolo[4,5-f]indole (PubChem CID 130891966) has the molecular formula C9H7F2NO2 and a molecular weight of 199.16 g/mol. Its IUPAC name is 2,2-difluoro-6,7-dihydro-5H-[1,3]dioxolo[4,5-f]indole.
| Compound Name | 2,2-difluoro-6,7-dihydro-5H-[1,3]dioxolo[4,5-f]indole |
|---|---|
| PubChem CID | 130891966 |
| Molecular Formula | C9H7F2NO2 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 2,2-difluoro-6,7-dihydro-5H-[1,3]dioxolo[4,5-f]indole |
| SMILES | FC1(F)Oc2cc3c(cc2O1)NCC3 |
| InChI | InChI=1S/C9H7F2NO2/c10-9(11)13-7-3-5-1-2-12-6(5)4-8(7)14-9/h3-4,12H,1-2H2 |
| InChIKey | ZHKHOECOSWDMAI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|