C9H15ClN2O3 — CID 130892325
2-chloro-N-[(2,5-dimethyloxolan-3-yl)carbamoyl]acetamide (PubChem CID 130892325) has the molecular formula C9H15ClN2O3 and a molecular weight of 234.68 g/mol. Its IUPAC name is 2-chloro-N-[(2,5-dimethyloxolan-3-yl)carbamoyl]acetamide.
| Compound Name | 2-chloro-N-[(2,5-dimethyloxolan-3-yl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 130892325 |
| Molecular Formula | C9H15ClN2O3 |
| Molecular Weight | 234.68 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-chloro-N-[(2,5-dimethyloxolan-3-yl)carbamoyl]acetamide |
| SMILES | CC1CC(NC(=O)NC(=O)CCl)C(C)O1 |
| InChI | InChI=1S/C9H15ClN2O3/c1-5-3-7(6(2)15-5)11-9(14)12-8(13)4-10/h5-7H,3-4H2,1-2H3,(H2,11,12,13,14) |
| InChIKey | UEOFRJYYSGZXSU-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.68 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|