C9H12FNO2 — CID 130892681
5-fluoro-1-(2-hydroxybutyl)pyridin-2-one (PubChem CID 130892681) has the molecular formula C9H12FNO2 and a molecular weight of 185.20 g/mol. Its IUPAC name is 5-fluoro-1-(2-hydroxybutyl)pyridin-2-one.
| Compound Name | 5-fluoro-1-(2-hydroxybutyl)pyridin-2-one |
|---|---|
| PubChem CID | 130892681 |
| Molecular Formula | C9H12FNO2 |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 5-fluoro-1-(2-hydroxybutyl)pyridin-2-one |
| SMILES | CCC(O)Cn1cc(F)ccc1=O |
| InChI | InChI=1S/C9H12FNO2/c1-2-8(12)6-11-5-7(10)3-4-9(11)13/h3-5,8,12H,2,6H2,1H3 |
| InChIKey | IRNGLLOJFAXRCK-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |