About (2S)-2-amino-N-(3,6-dihydro-2H-pyran-5-ylmethyl)propanamide
(2S)-2-amino-N-(3,6-dihydro-2H-pyran-5-ylmethyl)propanamide (PubChem CID 130892874) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is (2S)-2-amino-N-(3,6-dihydro-2H-pyran-5-ylmethyl)propanamide.
Molecular Properties
| Compound Name | (2S)-2-amino-N-(3,6-dihydro-2H-pyran-5-ylmethyl)propanamide |
| PubChem CID | 130892874 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | (2S)-2-amino-N-(3,6-dihydro-2H-pyran-5-ylmethyl)propanamide |
| SMILES | C[C@H](N)C(=O)NCC1=CCCOC1 |
| InChI | InChI=1S/C9H16N2O2/c1-7(10)9(12)11-5-8-3-2-4-13-6-8/h3,7H,2,4-6,10H2,1H3,(H,11,12)/t7-/m0/s1 |
| InChIKey | BZWJRRBZAFSLGE-ZETCQYMHSA-N |
| XLogP | -0.20 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-N-(3,6-dihydro-2H-pyran-5-ylmethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-N-(3,6-dihydro-2H-pyran-5-ylmethyl)propanamide?
The IUPAC name of (2S)-2-amino-N-(3,6-dihydro-2H-pyran-5-ylmethyl)propanamide (CID 130892874) is (2S)-2-amino-N-(3,6-dihydro-2H-pyran-5-ylmethyl)propanamide.
What is the SMILES notation for (2S)-2-amino-N-(3,6-dihydro-2H-pyran-5-ylmethyl)propanamide?
The canonical SMILES for (2S)-2-amino-N-(3,6-dihydro-2H-pyran-5-ylmethyl)propanamide is C[C@H](N)C(=O)NCC1=CCCOC1.
What is the InChIKey of (2S)-2-amino-N-(3,6-dihydro-2H-pyran-5-ylmethyl)propanamide?
The InChIKey is BZWJRRBZAFSLGE-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H16N2O2/c1-7(10)9(12)11-5-8-3-2-4-13-6-8/h3,7H,2,4-6,10H2,1H3,(H,11,12)/t7-/m0/s1.
What are the key properties of (2S)-2-amino-N-(3,6-dihydro-2H-pyran-5-ylmethyl)propanamide?
(2S)-2-amino-N-(3,6-dihydro-2H-pyran-5-ylmethyl)propanamide has a molecular weight of 184.24 g/mol, XLogP of -0.20, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-N-(3,6-dihydro-2H-pyran-5-ylmethyl)propanamide is sourced from PubChem (CID 130892874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).