C11H13ClO — CID 130894296
1-chloro-1-(2,6-dimethylphenyl)propan-2-one (PubChem CID 130894296) has the molecular formula C11H13ClO and a molecular weight of 196.68 g/mol. Its IUPAC name is 1-chloro-1-(2,6-dimethylphenyl)propan-2-one.
| Compound Name | 1-chloro-1-(2,6-dimethylphenyl)propan-2-one |
|---|---|
| PubChem CID | 130894296 |
| Molecular Formula | C11H13ClO |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 1-chloro-1-(2,6-dimethylphenyl)propan-2-one |
| SMILES | CC(=O)C(Cl)c1c(C)cccc1C |
| InChI | InChI=1S/C11H13ClO/c1-7-5-4-6-8(2)10(7)11(12)9(3)13/h4-6,11H,1-3H3 |
| InChIKey | RNEYDRYQKCKDCG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|