About 1-propan-2-yl-3-(1,1,1-trifluoro-2-methylpropan-2-yl)urea
1-propan-2-yl-3-(1,1,1-trifluoro-2-methylpropan-2-yl)urea (PubChem CID 130894538) has the molecular formula C8H15F3N2O
and a molecular weight of 212.21 g/mol. Its IUPAC name is 1-propan-2-yl-3-(1,1,1-trifluoro-2-methylpropan-2-yl)urea.
Molecular Properties
| Compound Name | 1-propan-2-yl-3-(1,1,1-trifluoro-2-methylpropan-2-yl)urea |
| PubChem CID | 130894538 |
| Molecular Formula | C8H15F3N2O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 1-propan-2-yl-3-(1,1,1-trifluoro-2-methylpropan-2-yl)urea |
| SMILES | CC(C)NC(=O)NC(C)(C)C(F)(F)F |
| InChI | InChI=1S/C8H15F3N2O/c1-5(2)12-6(14)13-7(3,4)8(9,10)11/h5H,1-4H3,(H2,12,13,14) |
| InChIKey | OVRAXSVDFNAHPE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-propan-2-yl-3-(1,1,1-trifluoro-2-methylpropan-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yl-3-(1,1,1-trifluoro-2-methylpropan-2-yl)urea?
The IUPAC name of 1-propan-2-yl-3-(1,1,1-trifluoro-2-methylpropan-2-yl)urea (CID 130894538) is 1-propan-2-yl-3-(1,1,1-trifluoro-2-methylpropan-2-yl)urea.
What is the SMILES notation for 1-propan-2-yl-3-(1,1,1-trifluoro-2-methylpropan-2-yl)urea?
The canonical SMILES for 1-propan-2-yl-3-(1,1,1-trifluoro-2-methylpropan-2-yl)urea is CC(C)NC(=O)NC(C)(C)C(F)(F)F.
What is the InChIKey of 1-propan-2-yl-3-(1,1,1-trifluoro-2-methylpropan-2-yl)urea?
The InChIKey is OVRAXSVDFNAHPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F3N2O/c1-5(2)12-6(14)13-7(3,4)8(9,10)11/h5H,1-4H3,(H2,12,13,14).
What are the key properties of 1-propan-2-yl-3-(1,1,1-trifluoro-2-methylpropan-2-yl)urea?
1-propan-2-yl-3-(1,1,1-trifluoro-2-methylpropan-2-yl)urea has a molecular weight of 212.21 g/mol, XLogP of 2.03, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yl-3-(1,1,1-trifluoro-2-methylpropan-2-yl)urea is sourced from PubChem (CID 130894538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).