C19H22N2 — CID 13089719
2-[diazo-(2,4,6-trimethylphenyl)methyl]-1,3,5-trimethylbenzene (PubChem CID 13089719) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-[diazo-(2,4,6-trimethylphenyl)methyl]-1,3,5-trimethylbenzene.
| Compound Name | 2-[diazo-(2,4,6-trimethylphenyl)methyl]-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 13089719 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 2-[diazo-(2,4,6-trimethylphenyl)methyl]-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(C(=[N+]=[N-])c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C19H22N2/c1-11-7-13(3)17(14(4)8-11)19(21-20)18-15(5)9-12(2)10-16(18)6/h7-10H,1-6H3 |
| InChIKey | NMGUJIWXEYBYIO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|