C19H12Cl2N6 — CID 1308987
10-benzyl-5-(2,4-dichlorophenyl)-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 1308987) has the molecular formula C19H12Cl2N6 and a molecular weight of 395.25 g/mol. Its IUPAC name is 10-benzyl-5-(2,4-dichlorophenyl)-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 10-benzyl-5-(2,4-dichlorophenyl)-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 1308987 |
| Molecular Formula | C19H12Cl2N6 |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 10-benzyl-5-(2,4-dichlorophenyl)-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Clc1ccc(-c2nnc3c4cnn(Cc5ccccc5)c4ncn23)c(Cl)c1 |
| InChI | InChI=1S/C19H12Cl2N6/c20-13-6-7-14(16(21)8-13)18-24-25-19-15-9-23-27(17(15)22-11-26(18)19)10-12-4-2-1-3-5-12/h1-9,11H,10H2 |
| InChIKey | MSKAHSLBHPNVOF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |