C10H12BrNOS — CID 130899090
1-[(3-bromothiophen-2-yl)methyl]-3-methylpyrrolidin-2-one (PubChem CID 130899090) has the molecular formula C10H12BrNOS and a molecular weight of 274.18 g/mol. Its IUPAC name is 1-[(3-bromothiophen-2-yl)methyl]-3-methylpyrrolidin-2-one.
| Compound Name | 1-[(3-bromothiophen-2-yl)methyl]-3-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 130899090 |
| Molecular Formula | C10H12BrNOS |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | 1-[(3-bromothiophen-2-yl)methyl]-3-methylpyrrolidin-2-one |
| SMILES | CC1CCN(Cc2sccc2Br)C1=O |
| InChI | InChI=1S/C10H12BrNOS/c1-7-2-4-12(10(7)13)6-9-8(11)3-5-14-9/h3,5,7H,2,4,6H2,1H3 |
| InChIKey | AEEHEBDJBSIVQU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |