C10H10FN3S — CID 130899396
6-fluoro-N-methyl-N-(1,3-thiazol-5-ylmethyl)pyridin-2-amine (PubChem CID 130899396) has the molecular formula C10H10FN3S and a molecular weight of 223.28 g/mol. Its IUPAC name is 6-fluoro-N-methyl-N-(1,3-thiazol-5-ylmethyl)pyridin-2-amine.
| Compound Name | 6-fluoro-N-methyl-N-(1,3-thiazol-5-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 130899396 |
| Molecular Formula | C10H10FN3S |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 6-fluoro-N-methyl-N-(1,3-thiazol-5-ylmethyl)pyridin-2-amine |
| SMILES | CN(Cc1cncs1)c1cccc(F)n1 |
| InChI | InChI=1S/C10H10FN3S/c1-14(6-8-5-12-7-15-8)10-4-2-3-9(11)13-10/h2-5,7H,6H2,1H3 |
| InChIKey | IQPBDPXXLJVUCW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|