About 2-nitropyrene
2-nitropyrene (PubChem CID 13090) has the molecular formula C16H9NO2
and a molecular weight of 247.25 g/mol. Its IUPAC name is 2-nitropyrene.
Molecular Properties
| Compound Name | 2-nitropyrene |
| PubChem CID | 13090 |
| Molecular Formula | C16H9NO2 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 2-nitropyrene |
| SMILES | O=[N+]([O-])c1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C16H9NO2/c18-17(19)14-8-12-6-4-10-2-1-3-11-5-7-13(9-14)16(12)15(10)11/h1-9H |
| InChIKey | MAZCGYFIOOIVHE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-nitropyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitropyrene?
The IUPAC name of 2-nitropyrene (CID 13090) is 2-nitropyrene.
What is the SMILES notation for 2-nitropyrene?
The canonical SMILES for 2-nitropyrene is O=[N+]([O-])c1cc2ccc3cccc4ccc(c1)c2c34.
What is the InChIKey of 2-nitropyrene?
The InChIKey is MAZCGYFIOOIVHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9NO2/c18-17(19)14-8-12-6-4-10-2-1-3-11-5-7-13(9-14)16(12)15(10)11/h1-9H.
What are the key properties of 2-nitropyrene?
2-nitropyrene has a molecular weight of 247.25 g/mol, XLogP of 4.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitropyrene is sourced from PubChem (CID 13090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).