About 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylthiourea
1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylthiourea (PubChem CID 130900513) has the molecular formula C7H11N3OS2
and a molecular weight of 217.32 g/mol. Its IUPAC name is 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylthiourea.
Molecular Properties
| Compound Name | 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylthiourea |
| PubChem CID | 130900513 |
| Molecular Formula | C7H11N3OS2 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylthiourea |
| SMILES | CNC(=S)NCc1cc(OC)ns1 |
| InChI | InChI=1S/C7H11N3OS2/c1-8-7(12)9-4-5-3-6(11-2)10-13-5/h3H,4H2,1-2H3,(H2,8,9,12) |
| InChIKey | PWUMPOHTHFEKDZ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylthiourea?
The IUPAC name of 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylthiourea (CID 130900513) is 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylthiourea.
What is the SMILES notation for 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylthiourea?
The canonical SMILES for 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylthiourea is CNC(=S)NCc1cc(OC)ns1.
What is the InChIKey of 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylthiourea?
The InChIKey is PWUMPOHTHFEKDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3OS2/c1-8-7(12)9-4-5-3-6(11-2)10-13-5/h3H,4H2,1-2H3,(H2,8,9,12).
What are the key properties of 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylthiourea?
1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylthiourea has a molecular weight of 217.32 g/mol, XLogP of 0.75, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-methoxy-1,2-thiazol-5-yl)methyl]-3-methylthiourea is sourced from PubChem (CID 130900513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).