C8H11N3OS — CID 130901261
N-[(6-methylpyridazin-3-yl)methyl]-2-sulfanylacetamide (PubChem CID 130901261) has the molecular formula C8H11N3OS and a molecular weight of 197.26 g/mol. Its IUPAC name is N-[(6-methylpyridazin-3-yl)methyl]-2-sulfanylacetamide.
| Compound Name | N-[(6-methylpyridazin-3-yl)methyl]-2-sulfanylacetamide |
|---|---|
| PubChem CID | 130901261 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | N-[(6-methylpyridazin-3-yl)methyl]-2-sulfanylacetamide |
| SMILES | Cc1ccc(CNC(=O)CS)nn1 |
| InChI | InChI=1S/C8H11N3OS/c1-6-2-3-7(11-10-6)4-9-8(12)5-13/h2-3,13H,4-5H2,1H3,(H,9,12) |
| InChIKey | OXYYWZMFLLBJHT-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|