C9H14O4 — CID 130901336
(2S)-2-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyacetaldehyde (PubChem CID 130901336) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is (2S)-2-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyacetaldehyde.
| Compound Name | (2S)-2-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyacetaldehyde |
|---|---|
| PubChem CID | 130901336 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | (2S)-2-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyacetaldehyde |
| SMILES | C=C[C@H]1OC(C)(C)O[C@@H]1[C@H](O)C=O |
| InChI | InChI=1S/C9H14O4/c1-4-7-8(6(11)5-10)13-9(2,3)12-7/h4-8,11H,1H2,2-3H3/t6-,7-,8-/m1/s1 |
| InChIKey | KOJQWLNDUMDSOW-BWZBUEFSSA-N |
| XLogP | 0.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|