About 4-oxo-5H-furo[3,2-c]pyridine-2-carbaldehyde
4-oxo-5H-furo[3,2-c]pyridine-2-carbaldehyde (PubChem CID 13090143) has the molecular formula C8H5NO3
and a molecular weight of 163.13 g/mol. Its IUPAC name is 4-oxo-5H-furo[3,2-c]pyridine-2-carbaldehyde.
Molecular Properties
| Compound Name | 4-oxo-5H-furo[3,2-c]pyridine-2-carbaldehyde |
| PubChem CID | 13090143 |
| Molecular Formula | C8H5NO3 |
| Molecular Weight | 163.13 g/mol |
| Exact Mass | 163.03 |
| IUPAC Name | 4-oxo-5H-furo[3,2-c]pyridine-2-carbaldehyde |
| SMILES | O=Cc1cc2c(=O)[nH]ccc2o1 |
| InChI | InChI=1S/C8H5NO3/c10-4-5-3-6-7(12-5)1-2-9-8(6)11/h1-4H,(H,9,11) |
| InChIKey | KJGUFTKAHLKJTJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.13 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-oxo-5H-furo[3,2-c]pyridine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-5H-furo[3,2-c]pyridine-2-carbaldehyde?
The IUPAC name of 4-oxo-5H-furo[3,2-c]pyridine-2-carbaldehyde (CID 13090143) is 4-oxo-5H-furo[3,2-c]pyridine-2-carbaldehyde.
What is the SMILES notation for 4-oxo-5H-furo[3,2-c]pyridine-2-carbaldehyde?
The canonical SMILES for 4-oxo-5H-furo[3,2-c]pyridine-2-carbaldehyde is O=Cc1cc2c(=O)[nH]ccc2o1.
What is the InChIKey of 4-oxo-5H-furo[3,2-c]pyridine-2-carbaldehyde?
The InChIKey is KJGUFTKAHLKJTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO3/c10-4-5-3-6-7(12-5)1-2-9-8(6)11/h1-4H,(H,9,11).
What are the key properties of 4-oxo-5H-furo[3,2-c]pyridine-2-carbaldehyde?
4-oxo-5H-furo[3,2-c]pyridine-2-carbaldehyde has a molecular weight of 163.13 g/mol, XLogP of 0.93, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-5H-furo[3,2-c]pyridine-2-carbaldehyde is sourced from PubChem (CID 13090143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).