C12H22O — CID 130903094
2-[(1S,3S)-1-methyl-2-methylidene-3-propan-2-ylcyclopentyl]ethanol (PubChem CID 130903094) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-[(1S,3S)-1-methyl-2-methylidene-3-propan-2-ylcyclopentyl]ethanol.
| Compound Name | 2-[(1S,3S)-1-methyl-2-methylidene-3-propan-2-ylcyclopentyl]ethanol |
|---|---|
| PubChem CID | 130903094 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 2-[(1S,3S)-1-methyl-2-methylidene-3-propan-2-ylcyclopentyl]ethanol |
| SMILES | C=C1[C@H](C(C)C)CC[C@@]1(C)CCO |
| InChI | InChI=1S/C12H22O/c1-9(2)11-5-6-12(4,7-8-13)10(11)3/h9,11,13H,3,5-8H2,1-2,4H3/t11-,12-/m0/s1 |
| InChIKey | ICOQGCPELUOUEK-RYUDHWBXSA-N |
| XLogP | 3.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|