About 2-chloro-N-[(2R,6R)-2,6-dimethylcyclohexyl]-N-prop-2-ynylacetamide
2-chloro-N-[(2R,6R)-2,6-dimethylcyclohexyl]-N-prop-2-ynylacetamide (PubChem CID 13090590) has the molecular formula C13H20ClNO
and a molecular weight of 241.76 g/mol. Its IUPAC name is 2-chloro-N-[(2R,6R)-2,6-dimethylcyclohexyl]-N-prop-2-ynylacetamide.
Molecular Properties
| Compound Name | 2-chloro-N-[(2R,6R)-2,6-dimethylcyclohexyl]-N-prop-2-ynylacetamide |
| PubChem CID | 13090590 |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-chloro-N-[(2R,6R)-2,6-dimethylcyclohexyl]-N-prop-2-ynylacetamide |
| SMILES | C#CCN(C(=O)CCl)C1[C@H](C)CCC[C@H]1C |
| InChI | InChI=1S/C13H20ClNO/c1-4-8-15(12(16)9-14)13-10(2)6-5-7-11(13)3/h1,10-11,13H,5-9H2,2-3H3/t10-,11-/m1/s1 |
| InChIKey | SVQGNSYXHKAWMF-GHMZBOCLSA-N |
| XLogP | 2.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-[(2R,6R)-2,6-dimethylcyclohexyl]-N-prop-2-ynylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[(2R,6R)-2,6-dimethylcyclohexyl]-N-prop-2-ynylacetamide?
The IUPAC name of 2-chloro-N-[(2R,6R)-2,6-dimethylcyclohexyl]-N-prop-2-ynylacetamide (CID 13090590) is 2-chloro-N-[(2R,6R)-2,6-dimethylcyclohexyl]-N-prop-2-ynylacetamide.
What is the SMILES notation for 2-chloro-N-[(2R,6R)-2,6-dimethylcyclohexyl]-N-prop-2-ynylacetamide?
The canonical SMILES for 2-chloro-N-[(2R,6R)-2,6-dimethylcyclohexyl]-N-prop-2-ynylacetamide is C#CCN(C(=O)CCl)C1[C@H](C)CCC[C@H]1C.
What is the InChIKey of 2-chloro-N-[(2R,6R)-2,6-dimethylcyclohexyl]-N-prop-2-ynylacetamide?
The InChIKey is SVQGNSYXHKAWMF-GHMZBOCLSA-N. The full InChI is InChI=1S/C13H20ClNO/c1-4-8-15(12(16)9-14)13-10(2)6-5-7-11(13)3/h1,10-11,13H,5-9H2,2-3H3/t10-,11-/m1/s1.
What are the key properties of 2-chloro-N-[(2R,6R)-2,6-dimethylcyclohexyl]-N-prop-2-ynylacetamide?
2-chloro-N-[(2R,6R)-2,6-dimethylcyclohexyl]-N-prop-2-ynylacetamide has a molecular weight of 241.76 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[(2R,6R)-2,6-dimethylcyclohexyl]-N-prop-2-ynylacetamide is sourced from PubChem (CID 13090590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).