C10H17NO3 — CID 130909539
3-(1-cyclopentyl-2-hydroxyethyl)-1,3-oxazolidin-2-one (PubChem CID 130909539) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 3-(1-cyclopentyl-2-hydroxyethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(1-cyclopentyl-2-hydroxyethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 130909539 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 3-(1-cyclopentyl-2-hydroxyethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1C(CO)C1CCCC1 |
| InChI | InChI=1S/C10H17NO3/c12-7-9(8-3-1-2-4-8)11-5-6-14-10(11)13/h8-9,12H,1-7H2 |
| InChIKey | RHKGNMKPSSWLNR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |