C10H21N3O — CID 130913539
3-(3,3-dimethylazetidin-1-yl)-2,2-dimethylpropanehydrazide (PubChem CID 130913539) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is 3-(3,3-dimethylazetidin-1-yl)-2,2-dimethylpropanehydrazide.
| Compound Name | 3-(3,3-dimethylazetidin-1-yl)-2,2-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 130913539 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 3-(3,3-dimethylazetidin-1-yl)-2,2-dimethylpropanehydrazide |
| SMILES | CC1(C)CN(CC(C)(C)C(=O)NN)C1 |
| InChI | InChI=1S/C10H21N3O/c1-9(2)5-13(6-9)7-10(3,4)8(14)12-11/h5-7,11H2,1-4H3,(H,12,14) |
| InChIKey | JKHZGAHKDLLLHE-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|